BD3121548
(S)-1,1-Diphenylpropan-2-amine , 97% , 67659-37-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3141.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-82 °C(lit.) |
| Boiling point: | 324.2±11.0 °C(Predicted) |
| Density | 1.022±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.21±0.10(Predicted) |
| optical activity | [α]20/D 16°, c = 1 in chloroform |
| InChI | 1S/C15H17N/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15H,16H2,1H3/t12-/m0/s1 |
| InChIKey | XNKICCFGYSXSAI-LBPRGKRZSA-N |
| SMILES | C[C@H](N)C(c1ccccc1)c2ccccc2 |
Description and Uses
(S)-(?;)-1,1-Diphenyl-2-aminopropane can be used as a model amine compound in the chirality sensing studies by organic probes using circular dichroism technique.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
