BD3173248
N,N-Dimethyl-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine , 98% , 5654-92-2
Synonym(s):
3-(Dimethylaminomethyl)-1H-pyrrolo[2,3-b]pyridine;7-Azagramine;Dimethyl-(1H-pyrrolo[2,3-b]-3-pyridinylmethyl)amine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB96.80 | In Stock |
|
| 250mg | RMB148.00 | In Stock |
|
| 1g | RMB369.60 | In Stock |
|
| 5g | RMB1299.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-149 °C |
| Boiling point: | 361.5±34.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.14±0.28(Predicted) |
| color | Pale Yellow to Yellow |
| InChI | InChI=1S/C10H13N3/c1-13(2)7-8-6-12-10-9(8)4-3-5-11-10/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | RFLCFQLBXWLHKX-UHFFFAOYSA-N |
| SMILES | C12NC=C(CN(C)C)C1=CC=CN=2 |
Description and Uses
7-Azaindole derivative
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

![N,N-Dimethyl-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine](https://img.chemicalbook.com/CAS/GIF/5654-92-2.gif)


![3-(Piperazin-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/625386-57-4.gif)
![1-Boc-3-[(dimethylamino)methyl]-7-azaindole](https://img.chemicalbook.com/CAS/GIF/144657-65-8.gif)

