BD3217845
4-Bromo-3-(trifluoromethyl)benzene-1-sulfonylchloride , 98% , 351003-47-9
CAS NO.:351003-47-9
Empirical Formula: C7H3BrClF3O2S
Molecular Weight: 323.51
MDL number: MFCD03094391
EINECS: 624-201-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB71.20 | In Stock |
|
| 5g | RMB139.20 | In Stock |
|
| 10g | RMB257.60 | In Stock |
|
| 25g | RMB456.00 | In Stock |
|
| 100g | RMB1617.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-33°C |
| Boiling point: | 92-94°C/0.35mm |
| Density | 1.833 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | Colorless to light yellow <32°C Solid,>33°C Liquid |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3BrClF3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H |
| InChIKey | QCFIMBHKZZLZAE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(ccc1Br)S(Cl)(=O)=O |
| CAS DataBase Reference | 351003-47-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






