BD3240545
4-(Methoxycarbonyl)cyclohexanecarboxylicacid , 95% , 32529-79-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB38.40 | In Stock |
|
| 5g | RMB93.60 | In Stock |
|
| 10g | RMB180.80 | In Stock |
|
| 25g | RMB440.00 | In Stock |
|
| 100g | RMB1688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114℃ |
| Boiling point: | 303.1±35.0℃ (760 Torr) |
| Density | 1.191±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 118.3±19.4℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.66±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Slightly soluble in water (11 g/L at 25°C). |
| InChI | InChI=1S/C9H14O4/c1-13-9(12)7-4-2-6(3-5-7)8(10)11/h6-7H,2-5H2,1H3,(H,10,11) |
| InChIKey | ZQJNPHCQABYENK-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)CCC(C(O)=O)CC1 |
Description and Uses
4-(Methoxycarbonyl)cyclohexane-1-carboxylic acid is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2917198090 |






![Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride](https://img.chemicalbook.com/CAS/GIF/1719-83-1.gif)
![Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylicacid,1-methylester](https://img.chemicalbook.com/CAS/GIF/24539-28-4.gif)