BD3351551
Tetra-2-pyridinylpyrazine , 97+% , 25005-97-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB150.40 | In Stock |
|
| 250mg | RMB310.40 | In Stock |
|
| 1g | RMB1024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 292-294 °C(lit.) |
| Boiling point: | 519.8±45.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.68±0.19(Predicted) |
| InChI | 1S/C24H16N6/c1-5-13-25-17(9-1)21-22(18-10-2-6-14-26-18)30-24(20-12-4-8-16-28-20)23(29-21)19-11-3-7-15-27-19/h1-16H |
| InChIKey | UOJZYBFRNITHCX-UHFFFAOYSA-N |
| SMILES | c1ccc(nc1)-c2nc(-c3ccccn3)c(nc2-c4ccccn4)-c5ccccn5 |
| EPA Substance Registry System | Pyrazine, tetra-2-pyridinyl- (25005-97-4) |
Description and Uses
Tetra-2-pyridinylpyrazine (tppz, tpyprz) may be used as a ligand in the synthesis of the following metal complexes:
- [{CuCl}2(μ-tppz)][PF6]2 (PF6=hexafluorophosphate)
- [(Cp*2Ln)2(μ-tppz.)](BPh4) (Cp*=pentamethylcyclopentadienyl; Ln=Gd, Tb, Dy; BPh4=tetraphenyl borate)
- [Fe(tpyprz)2]2[Mo8O26]·3.7H2O (Mo8O26=octamolybdate)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
