PRODUCT Properties
| Melting point: | 29°C |
| Boiling point: | 150 °C / 10mmHg |
| Density | 0.98 |
| refractive index | 1.5458 (estimate) |
| Flash point: | 28 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| InChI | InChI=1S/C15H16/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15/h3-10H,11H2,1-2H3 |
| InChIKey | HZAWPPRBCALFRN-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(CC2=CC=C(C)C=C2)C=C1 |
Description and Uses
Di-p-tolylmethane used in preparation of Carbazole Pyridine compound for OLED.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H330 |
| Precautionary statements | P260-P264-P270-P271-P284-P301+P312+P330-P304+P340+P310-P403+P233-P405-P501 |
| RIDADR | 2811 |
| RTECS | PA9100000 |
| HS Code | 2902.90.9000 |
| HazardClass | 6.1 |
| PackingGroup | II |
