BD4185646
Methyl2,4-dioxopentanoate , 98% , 20577-61-1
Synonym(s):
1-Methoxy-1,2,4-pentanetrione;Methyl β-acetylpyruvate;Methyl 2,4-dioxopentanoate;Methyl 2,4-dioxovalerate;Methyl 3-acetylpyruvate
CAS NO.:20577-61-1
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00043638
EINECS: 243-891-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB126.40 | In Stock |
|
| 25g | RMB366.40 | In Stock |
|
| 100g | RMB1440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65 °C |
| Boiling point: | 195℃ |
| Density | 1.150 |
| Flash point: | 76℃ |
| storage temp. | 2-8°C |
| pka | 6.79±0.46(Predicted) |
| form | solid |
| color | Yellow |
| InChI | InChI=1S/C6H8O4/c1-4(7)3-5(8)6(9)10-2/h3H2,1-2H3 |
| InChIKey | OMHOEQINEXASKE-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(=O)CC(=O)C |
| CAS DataBase Reference | 20577-61-1(CAS DataBase Reference) |
Description and Uses
METHYL ACETOPYRUVATE is an intermediate of sulfamethoxazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xi |
| Risk Statements | 36 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |






