BD4198046
(2S,4R)-1-tert-Butyl2-methyl4-fluoropyrrolidine-1,2-dicarboxylate , 97% , 203866-18-6
Synonym(s):
1-tert-Butyl 2-methyl (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB300.80 | In Stock |
|
| 10g | RMB580.80 | In Stock |
|
| 25g | RMB1257.60 | In Stock |
|
| 100g | RMB3976.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-39 °C |
| Density | 1.16 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| form | powder |
| Appearance | Colorless to off-white <36°C Solid,>39°C Liquid |
| optical activity | [α]22/D -80.0°, c = 1 in methanol |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C11H18FNO4/c1-11(2,3)17-10(15)13-6-7(12)5-8(13)9(14)16-4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | METPQQHVRNLTRX-SFYZADRCSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](F)C[C@H]1C(OC)=O |
Description and Uses
N-Boc-trans-4-fluoro-L-proline methyl ester is used to prepare (S)-2-[N-(N'-benzyl-(S)-4-fluoro-L-prolyl)amino]benzophenone by reacting with of 2-aminobenzophenone in the presence of potassium tert -butoxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264b-P270-P280-P301+P312-P302+P352-P305+P351+P338-P330-P332+P313-P337+P313-P362+P364-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |






