BD4564241
4-(((2,4-Diaminopteridin-6-yl)methyl)(methyl)amino)benzoicacid , 95% , 19741-14-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB544.00 | In Stock |
|
| 250mg | RMB1056.00 | In Stock |
|
| 1g | RMB2639.20 | In Stock |
|
| 250g | RMB20000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255 °C (dec.)(lit.) |
| Boiling point: | 689.3±65.0 °C(Predicted) |
| Density | 1.532 |
| storage temp. | 2-8°C(protect from light) |
| solubility | Aqueous Base, DMSO |
| pka | 4.63±0.10(Predicted) |
| form | Solid |
| color | Dark Yellow to Very Dark Brown |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C15H15N7O2/c1-22(10-4-2-8(3-5-10)14(23)24)7-9-6-18-13-11(19-9)12(16)20-15(17)21-13/h2-6H,7H2,1H3,(H,23,24)(H4,16,17,18,20,21) |
| InChIKey | LWCXZSDKANNOAR-UHFFFAOYSA-N |
| SMILES | N(Cc2nc3c(nc(nc3N)N)nc2)(C)c1ccc(cc1)C(=O)O |
| CAS DataBase Reference | 19741-14-1 |
Description and Uses
DAMPA is a Methotrexate (M260675) analog (1). DAMPA is an antitumor agent (2).
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H341-H360D |
| Precautionary statements | P202-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 43-52/53 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Muta. 2 Repr. 1B Skin Irrit. 2 |
