BD5023041
(1R,2R)-N-Boc-1,2-cyclohexanediamine , 98% , 146504-07-6
Synonym(s):
(1R)-trans-N-Boc-1,2-diaminocyclohexane
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB56.00 | In Stock |
|
| 1g | RMB144.80 | In Stock |
|
| 5g | RMB460.80 | In Stock |
|
| 10g | RMB856.00 | In Stock |
|
| 25g | RMB1904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-115℃ |
| Boiling point: | 322.1±31.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 12.26±0.40(Predicted) |
| color | White to Almost white |
| optical activity | [α]/D -26±2°, c = 1 in chloroform |
| BRN | 7023564 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | AKVIZYGPJIWKOS-RKDXNWHRSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCCC[C@H]1N |
Description and Uses
(1R,2R)-trans-N-Boc-1,2-cyclohexanediamine can be used as:
- An organocatalyst in the intramolecular desymmetrization of cyclohexanones to yield 2-azabicyclo[3.3.1]nonane.
- A starting material in the synthesis of a chiral nickel catalyst applicable for the Michael addition reaction of 1,3-dicarbonyl compounds to yield nitroalkenes.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29242990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







