A7124012
(1R,2R)-(-)-N-p-Tosyl-1,2-diphenylethylenediamine 98% , 98% , 144222-34-4
CAS NO.：144222-34-4
Empirical Formula: C21H22N2O2S
Molecular Weight: 366.48
MDL number: MFCD02093428
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.00 | In Stock |
|
| 5G | RMB358.40 | In Stock |
|
| 25G | RMB1518.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-131 °C(lit.) |
| alpha | -61.5 º (c=1, CH2Cl2) |
| Boiling point: | 537.3±60.0 °C(Predicted) |
| Density | 1.1440 (rough estimate) |
| refractive index | -30 ° (C=0.4, CHCl3) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| pka | 10.76±0.50(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to slightly yellow |
| optical activity | [α]20/D 35°, c = 1 in chloroform |
| Water Solubility | insoluble |
| InChI | InChI=1S/C21H22N2O2S/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15,20-21,23H,22H2,1H3/t20-,21-/m1/s1 |
| InChIKey | UOPFIWYXBIHPIP-NHCUHLMSSA-N |
| SMILES | C1(S(N[C@H](C2=CC=CC=C2)[C@H](N)C2=CC=CC=C2)(=O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 144222-34-4(CAS DataBase Reference) |
Description and Uses
Chiral diamine ligand for cooperative metal-Bronsted acid catalyzed greener reductive amination using hydrogen gas.
Metal-Br?nsted Acid Cooperative Catalysis for Asymmetric Reductive Amination
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29215900 |
