BD7596131
2-(p-Tolyl)propanoic acid , 98% , 938-94-3
Synonym(s):
2-(4-Methylphenyl)propanoic acid;Ibuprofen Impurity D (Ph. Eur.);Ibuprofen impurity D (PhEur);α,4-Dimethylphenylacetic acid;(2RS)-2-(4-Methylphenyl)propionic acid
CAS NO.:938-94-3
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD01111378
EINECS: 627-324-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 10g | RMB40.00 | In Stock |
|
| 25g | RMB52.00 | In Stock |
|
| 100g | RMB204.80 | In Stock |
|
| 500g | RMB859.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-42 °C(lit.) |
| Boiling point: | 231.67°C (rough estimate) |
| Density | 1.0041 (rough estimate) |
| refractive index | 1.518-1.52 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.44±0.10(Predicted) |
| color | White to Off-White |
| BRN | 2251315 |
| InChI | InChI=1S/C10H12O2/c1-7-3-5-9(6-4-7)8(2)10(11)12/h3-6,8H,1-2H3,(H,11,12) |
| InChIKey | KDYOFXPLHVSIHS-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(C)=CC=1)(C)C(=O)O |
| CAS DataBase Reference | 938-94-3(CAS DataBase Reference) |
Description and Uses
2-(p-Tolyl)propionic acid (Ibuprofen EP Impurity D) is an impurity of Ibuprofen (I140000). Ibuprofen impurity D.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29163990 |







