BD7963931
Fmoc-Ser(tBu)-OPfp , 98+% , 105751-13-1
Synonym(s):
Fmoc-Ser(tBu)-OPfp;N-α-Fmoc-O-t.-butyl-L-serine pentafluorophenyl ester
CAS NO.:105751-13-1
Empirical Formula: C28H24F5NO5
Molecular Weight: 549.49
MDL number: MFCD00062213
| Pack Size | Price | Stock | Quantity |
| 25g | RMB3690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-71℃ |
| Boiling point: | 628.2±55.0 °C(Predicted) |
| Density | 1.349±0.06 g/cm3(Predicted) |
| storage temp. | Store at -15°C to -25°C. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 9.82±0.46(Predicted) |
| Appearance | brown oil |
| Major Application | peptide synthesis |
| InChIKey | DOUJYVMLNKRFHE-IBGZPJMESA-N |
| SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)COC(C)(C)C)F)F |
Description and Uses
Fmoc-Ser(tBu)-OPfp is used as a reactant in the synthesis of peptides and peptide derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







