BD8033331
Methyl 4-(cyanoacetyl)benzoate , 96% , 69316-08-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.80 | In Stock |
|
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB354.40 | In Stock |
|
| 10g | RMB645.60 | In Stock |
|
| 25g | RMB1304.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C (lit.) |
| Boiling point: | 341.49°C (rough estimate) |
| Density | 1.2621 (rough estimate) |
| refractive index | 1.4950 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 7.01±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C11H9NO3/c1-15-11(14)9-4-2-8(3-5-9)10(13)6-7-12/h2-5H,6H2,1H3 |
| InChIKey | CTZGTFNYYYZXTE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)C(=O)CC#N |
Description and Uses
Methyl 4-(cyanoacetyl)benzoate may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
