BD8384431
Ethyl 2-(3-formyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate , 98% , 161798-03-4
CAS NO.:161798-03-4
Empirical Formula: C18H21NO4S
Molecular Weight: 347.43
MDL number: MFCD13194811
EINECS: 700-743-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB68.00 | In Stock |
|
| 250mg | RMB102.40 | In Stock |
|
| 1g | RMB236.80 | In Stock |
|
| 5g | RMB787.20 | In Stock |
|
| 10g | RMB1520.00 | In Stock |
|
| 25g | RMB3005.60 | In Stock |
|
| 100g | RMB7041.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Boiling point: | 495.9±55.0 °C(Predicted) |
| Density | 1.183 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 1.39±0.10(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C18H21NO4S/c1-5-22-18(21)16-12(4)19-17(24-16)13-6-7-15(14(8-13)9-20)23-10-11(2)3/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | AIQMFFCWDAIGNV-UHFFFAOYSA-N |
| SMILES | S1C(C(OCC)=O)=C(C)N=C1C1=CC=C(OCC(C)C)C(C=O)=C1 |
| CAS DataBase Reference | 161798-03-4(CAS DataBase Reference) |
Description and Uses
Ethyl 2-(3-formyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate is an impurity of Febuxostat (F229000), which is a xanthine oxidase/xanthine dehydrogenase inhibitor, used for treatment of hyperuricemia and chronic gout.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |







