BD8658931
4,6-Dichloroisatin , 98% , 18711-15-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB204.00 | In Stock |
|
| 10g | RMB367.20 | In Stock |
|
| 25g | RMB861.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260.5-261℃ |
| Density | 1.643±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.59±0.20(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C8H3Cl2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13) |
| InChIKey | CGCVHJCZBIYRQC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Cl)=CC(Cl)=C2)C(=O)C1=O |
Description and Uses
CFL-120 is a potent KRasG12C inhibitor. CFL-120 shows an antiproliferative effect. CFL-120 shows anticancer activity. CFL-120 has the potential for the research of lung cancer[1].
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H335 |
| Precautionary statements | P262-P280-P301+P310-P304+P340-P305+P351+P338-P310 |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
