F116223
3,4-Dimethoxy-L-phenylalanine , 97 , 32161-30-1
CAS NO.:32161-30-1
Empirical Formula: C11H15NO4
Molecular Weight: 225.24
MDL number: MFCD01321274
EINECS: 626-580-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1691.20 | In Stock |
|
| 5g | RMB6338.40 | In Stock |
|
| 25g | RMB25232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-257 °C(lit.) |
| alpha | -5 º (c=4 in 1 M HCl) |
| Boiling point: | 374.3±42.0 °C(Predicted) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | Store at 0°C |
| solubility | Aqueous Acid (Slightly, Heated Sonicated), Aqueous Base (Slightly), Water (Slightly) |
| pka | 2.23±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D 5°, c = 4 in 1 M HCl |
| Sensitive | Air Sensitive |
| Stability: | Hygroscopic, Temperature Sensitive |
| InChI | InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | VWTFNYVAFGYEKI-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(OC)C(OC)=C1)N |
| CAS DataBase Reference | 32161-30-1(CAS DataBase Reference) |
Description and Uses
3-(3,4-Dimethoxyphenyl)-L-alanine can be used as a reactant to synthesize (2S)-2-amino-3-[3,4-di(methoxy)phenyl]propan-1-ol (β-amino alcohol) for use as a key intermediate to prepare tetracyclic core of the Erythrina alkaloids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| HS Code | 29224999 |






