PRODUCT Properties
| Melting point: | 268 °C (decomp) |
| Boiling point: | 407.3±45.0 °C(Predicted) |
| Density | 1.321 |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Aqueous Acid (Slightly), Water (Very Slightly, Heated) |
| pka | 2.24±0.20(Predicted) |
| form | Solid |
| color | White to Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H13NO4/c1-15-9-5-6(2-3-8(9)12)4-7(11)10(13)14/h2-3,5,7,12H,4,11H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | PFDUUKDQEHURQC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C(OC)=C1)N |
Description and Uses
rac 3-O-Methyl DOPA (Levodopa EP Impurity C) is an impurity of Levodopa (D533751). A useful marker that can be used to screen for the absense of Aromatic L-amino acid decarboxylase (AADC).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |






