PRODUCT Properties
| Melting point: | 165-167°C |
| Boiling point: | 497.4±45.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO : 33.33 mg/mL (106.72 mM; Need ultrasonic) |
| form | Solid |
| color | White to light yellow |
| InChI | 1S/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | HJNJAUYFFFOFBW-UHFFFAOYSA-N |
| SMILES | COc1cc2OC(=CC(=O)c2c(OC)c1OC)c3ccccc3 |
| LogP | 2.990 (est) |
| CAS DataBase Reference | 973-67-1(CAS DataBase Reference) |
Description and Uses
5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
