PRODUCT Properties
| Melting point: | 142-143°C |
| Boiling point: | 525.7±50.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Light Brown |
| InChI | 1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3 |
| InChIKey | URSUMOWUGDXZHU-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(OC)C(OC)=C(OC)C=C2OC(C3=CC=C(OC)C=C3)=C1 |
| LogP | 3.260 (est) |
Description and Uses
Scutellarein Tetramethyl Ether can be used to inhibit breast cancer resistance protein (BCRP).
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
