M0420150
Ethyl2-(4-isobutylphenyl)propanoate , 95% , 41283-72-1
CAS NO.:41283-72-1
Empirical Formula: C15H22O2
Molecular Weight: 234.34
MDL number: MFCD00869901
EINECS: 255-291-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB320.00 | In Stock |
|
| 1g | RMB916.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 260-262 °C |
| Density | 0.967±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| InChI | 1S/C15H22O2/c1-5-17-15(16)12(4)14-8-6-13(7-9-14)10-11(2)3/h6-9,11-12H,5,10H2,1-4H3 |
| InChIKey | HXTFUVWJFLDLJP-UHFFFAOYSA-N |
| SMILES | O(CC)C(=O)C(C)c1ccc(cc1)CC(C)C |
Description and Uses
Ibuprofen Ethyl Ester is a derivative of Ibuprofen, a nonsteroidal anti-inflammatory drug (NSAID) that is known to inhibit PGH synthase-1 and PGH synthase-2 with comparable potency.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280-P271 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |







![2-[4-(2-Methylpropyl)phenyl] ethanol](https://img.chemicalbook.com/CAS/20130318/GIF/CB12605071.gif)