PRODUCT Properties
| Melting point: | 230-231℃ (ethanol ) |
| Boiling point: | 803.5±65.0 °C(Predicted) |
| Density | 1.76±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Methanol : 16.67 mg/mL (39.85 mM) |
| form | Solid |
| pka | 6.20±0.40(Predicted) |
| color | White to yellow |
| InChI | InChI=1/C20H18O10/c21-7-13-15(25)17(27)20(29-13)30-19-16(26)14-11(24)5-10(23)6-12(14)28-18(19)8-1-3-9(22)4-2-8/h1-6,13,15,17,20-25,27H,7H2/t13-,15-,17+,20/s3 |
| InChIKey | POQICXMTUPVZMX-XQAOVFCONA-N |
| SMILES | C1(C2=CC=C(O)C=C2)OC2=C(C(=CC(=C2)O)O)C(=O)C=1OC1O[C@H](CO)[C@@H](O)[C@@H]1O |&1:23,26,28,r| |
Description and Uses
Juglanin inhibits the proliferation of breast cancer cell in a dose- and time-dependent manner and presents less cytotoxic against the normal cells. It is a JNK activator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933998090 |
