M3564257
Vedaprofen , 71109-09-6
CAS NO.：71109-09-6
Empirical Formula: C19H22O2
Molecular Weight: 282.38
MDL number: MFCD00866019
EINECS: 275-196-6
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150°C |
| Boiling point: | 465.9±14.0 °C(Predicted) |
| Density | 1.132±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMF: 25 mg/ml; DMSO: 10 mg/ml; Ethanol: 10 mg/ml |
| pka | 4.90±0.30(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 5568831 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21) |
| InChIKey | VZUGVMQFWFVFBX-UHFFFAOYSA-N |
| SMILES | CC(C(O)=O)c1ccc(C2CCCCC2)c3ccccc13 |
| EPA Substance Registry System | 1-Naphthaleneacetic acid, 4-cyclohexyl-.alpha.-methyl- (71109-09-6) |
Description and Uses
Propionic acid type non-steroidal anti-inflammatory drug (NSAID).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orally in rat: 400 mg/kg (Godfroid) |
