S1365716
≥98%(HPLC) , 586379-66-0
Synonym(s):
3-[3-Bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1(2H)-pyridinyl]-N,4-dimethyl-benzamide;3-Bromo-4-[(2,4-difluorobenzyl)oxy]-1-[5-[(methylamino)carbonyl]-2-methylphenyl]-6-methylpyridin-2(1H)-one;PH 797804
CAS NO.：586379-66-0
Empirical Formula: C22H19BrF2N2O3
Molecular Weight: 477.3
MDL number: MFCD18251426
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1033.47 | In Stock |
|
| 25mg | RMB4165.50 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 593.206±50.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.51 |
| storage temp. | 20-25°C |
| solubility | ≥23.85 mg/mL in DMSO; insoluble in H2O; insoluble in EtOH |
| form | powder |
| pka | 15.145±0.46(predicted) |
| color | white to beige |
| InChI | 1S/C22H19BrF2N2O3/c1-12-4-5-14(21(28)26-3)9-18(12)27-13(2)8-19(20(23)22(27)29)30-11-15-6-7-16(24)10-17(15)25/h4-10H,11H2,1-3H3,(H,26,28) |
| InChIKey | KCAJXIDMCNPGHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(OCC2=C(F)C=C(F)C=C2)=C(Br)C(N1C3=CC(C(NC)=O)=CC=C3C)=O |
| CAS DataBase Reference | 586379-66-0 |
Description and Uses
PH-797804 is a novel N-phenylpyridinone inhibitor of p38 mitogen-activated protein (MAP) kinase derived from a racemic mixture as the more potent atropisomer and is also known to exerts anti-inflammatory properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P304+P340+P312-P305+P351+P338-P337+P313 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
