S2473449
AvantiPolarLipids870450O , 53847-30-6
Synonym(s):
(all-Z)-5,8,11,14-Eicosatetraenoic acid 2-hydroxy-1-(hydroxymethyl)ethyl ester;2-AG;2-arachidonoyl glycerol;2-Arachidonoylglycerol;2-Monoarachidonoylglycerol
CAS NO.:53847-30-6
Empirical Formula: C23H38O4
Molecular Weight: 378.55
MDL number: MFCD01862600
EINECS: 200-835-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1212.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 508.6±50.0 °C(Predicted) |
| Density | 0.992±0.06 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | -20°C |
| solubility | DMSO: 10 mg/ml; Ethanol: Miscible; PBS (pH 7.2): ~150 μg/ml |
| pka | 13.54±0.10(Predicted) |
| form | acetonitrile solution |
| color | Colorless to light yellow |
| InChIKey | RCRCTBLIHCHWDZ-DOFZRALJSA-N |
| SMILES | [H]C(CO)(OC(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O)CO |
| CAS DataBase Reference | 53847-30-6(CAS DataBase Reference) |
Description and Uses
2-Arachidonoylglycerol is a major endocannabinoid, which can inhibit synaptic transmission by presynaptic cannabinoid CB1 receptors. It plays an inhibitory role in the bombesin-induced activation of central adrenomedullary outflow in rats.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 26-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 2 |
| Storage Class | 12 - Non Combustible Liquids |





