S5811849
N,N-Dimethyl-d6-formamide , ≥98atom%D,≥98%(CP) , 185990-36-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB17833.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -61 °C (lit.) |
| Boiling point: | 153 °C (lit.) |
| Density | 1.024 g/mL at 25 °C |
| Flash point: | 58 °C |
| InChI | 1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| InChIKey | ZMXDDKWLCZADIW-WFGJKAKNSA-N |
| SMILES | [H]C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Description and Uses
N,N-Dimethyl-d6-formamide is an isotope labelled compound of N,N-Dimethylformamide (D473905). N,N-Dimethylformamide can be used as analyte in analytical study and in physical, engineering or chemical process for preparation of dinuclear (phenyl)gold(I) biphenyl diisocyanide complex and its solvent-responsive photoluminescence with mech. reactivation.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H312+H332-H319-H360 |
| Precautionary statements | P210-P280-P303+P361+P353-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 61-20/21-36 |
| Safety Statements | 53-45 |
| RIDADR | UN 2265 3/PG 3 |
| WGK Germany | 1 |
| RTECS | LQ2100000 |
| HS Code | 2845901000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Liq. 3 Repr. 1B |








