S6482749
N-Nitrosodiphenylamine-2,2′,4,4′,6,6′-d6 , 98atom%D , 93951-95-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB10726.86 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-66 °C (lit.) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| color | Dark Green to Very Dark Green |
| Stability: | Light Sensitive |
| InChI | 1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,2D,7D,8D,9D,10D |
| InChIKey | UBUCNCOMADRQHX-MWJWXFQUSA-N |
| SMILES | [2H]c1cc([2H])c(c([2H])c1)N(N=O)c2c([2H])cc([2H])cc2[2H] |
| EPA Substance Registry System | N-Nitrosodiphenylamine-d6 (93951-95-2) |
| CAS Number Unlabeled | 86-30-6 |
Description and Uses
N-Nitrosodiphenyl-2,2'',4,4'',6,6''-d6-amine (CAS# 93951-95-2) is a useful isotopically labeled research compound.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H411 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| target organs | Urinary bladder |
| Hazard Codes | Xi,N |
| Risk Statements | 36/38-43-51/53 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 1 Carc. 2 Repr. 2 Skin Sens. 1A STOT RE 2 |






