A6240312
N-Nitroso-N-methylaniline , ≥98.0% , 614-00-6
CAS NO.:614-00-6
Empirical Formula: C7H8N2O
Molecular Weight: 136.15
MDL number: MFCD00045675
EINECS: 210-366-5
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB67.20 | In Stock |
|
| 5ML | RMB173.60 | In Stock |
|
| 25ML | RMB692.00 | In Stock |
|
| 100ML | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13°C |
| Boiling point: | 128 °C / 19mmHg |
| Density | 1,13 g/cm3 |
| refractive index | 1.5750 to 1.5790 |
| Flash point: | 13 °C |
| storage temp. | -20°C Freezer |
| Water Solubility | Insoluble in water |
| solubility | Chloroform: soluble; DMSO: soluble; Ethanol: soluble; Methanol: soluble |
| pka | -1.54±0.50(Predicted) |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| Henry's Law Constant | 2.0×100 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C7H8N2O/c1-9(8-10)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | MAXCWSIJKVASQC-UHFFFAOYSA-N |
| SMILES | C1(N(C)N=O)=CC=CC=C1 |
| CAS DataBase Reference | 614-00-6(CAS DataBase Reference) |
| EPA Substance Registry System | N-Methyl-N-nitrosoaniline (614-00-6) |
Description and Uses
N-Nitroso-N-methylaniline is used in the preparation of resin.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311 |
| Precautionary statements | P501-P270-P264-P280-P361+P364-P301+P310+P330-P302+P352+P312-P405 |
| Hazard Codes | T |
| Risk Statements | 25-36-40-22-45 |
| Safety Statements | 23-26-46-53-45 |
| RIDADR | 2810 |
| RTECS | BY5775000 |
| TSCA | TSCA listed |
| HS Code | 2921.44.1000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Hazardous Substances Data | 614-00-6(Hazardous Substances Data) |





