S6509749
tert-Butanol-d10 , 99atom%D , 53001-22-2
Synonym(s):
tert-Butyl alcohol-d10;2-Methyl-2-propanol-d10
CAS NO.:53001-22-2
Empirical Formula: C4D10O
Molecular Weight: 84.18
MDL number: MFCD00064244
EINECS: 258-288-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB946.99 | In Stock |
|
| 5g | RMB2273.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 82 °C(lit.) |
| Density | 0.893 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 52 °F |
| storage temp. | Flammables area |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1D3,2D3,3D3,5D |
| InChIKey | DKGAVHZHDRPRBM-SGLLWXCUSA-N |
| SMILES | C(O[2H])(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| EPA Substance Registry System | 2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)- (53001-22-2) |
| CAS Number Unlabeled | 75-65-0 |
| CAS Number Unlabeled | 75-65-0 |
Description and Uses
TERT-BUTANOL-D10 is used as an internal standard for the quantification of Tert-butanol by GC- or LC-mass spectrometry
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H332-H335 |
| Precautionary statements | P210-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20-36/37 |
| Safety Statements | 9-16-46 |
| RIDADR | UN 1120 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







