S9066714
powder,≥99%(HPLC) , 1596-56-1
Synonym(s):
3-Hydroxy-2-naphtho-2′,4′-xylidide Phosphate;N-(2,4-Dimethylphenyl)-3-(phosphonooxy)-2-naphthalenecarboxamide
CAS NO.：1596-56-1
Empirical Formula: C19H18NO5P
Molecular Weight: 371.32
MDL number: MFCD00042711
EINECS: 216-480-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB404.99 | In Stock |
|
| 500mg | RMB1151.69 | In Stock |
|
| 1g | RMB1993.17 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-190°C |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | ethanol: 50mg/mL, clear to slightly hazy, colorless to faintly yellow (to Faint Brown) |
| form | powder |
| pka | 0.80±0.30(Predicted) |
| color | White to off-white |
| BRN | 6664873 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C19H18NO5P/c1-12-7-8-17(13(2)9-12)20-19(21)16-10-14-5-3-4-6-15(14)11-18(16)25-26(22,23)24/h3-11H,1-2H3,(H,20,21)(H2,22,23,24) |
| InChIKey | IOMLBTHPCVDRHM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3cc2OP(O)(O)=O)c(C)c1 |
| CAS DataBase Reference | 1596-56-1 |
Description and Uses
Naphthol AS-MX phosphate has been used as:
- a substrate for alkaline phosphatase in human osteoblasts
- mouse embryonic stem cell (mESC)
- coronal plane sections for fluorescence staining and analysis
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H290 |
| Precautionary statements | P234-P390 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
