T0142731
Tyrphostin A1 , >98.0%(GC) , 2826-26-8
Synonym(s):
(4-Methoxybenzylidene)malononitrile
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB532.00 | In Stock |
|
| 1g | RMB1932.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-116 °C(lit.) |
| Boiling point: | 352.4±27.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble50mg/mL, clear, light yellow |
| form | Yellow solid |
| color | Light orange to Yellow to Green |
| Sensitive | Light Sensitive |
| λmax | 350nm(H2O)(lit.) |
| InChI | 1S/C11H8N2O/c1-14-11-4-2-9(3-5-11)6-10(7-12)8-13/h2-6H,1H3 |
| InChIKey | UOHFCPXBKJPCAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)\C=C(/C#N)C#N |
Description and Uses
Tyrphostin A1 is an inactive Tyrphostin used as a negative control for Tyrphostin A23.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | UN 3439 6.1/PG III |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |







