A0514656
Dichloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II)RuCl2[(R)-xylbinap][(R,R)-dpen] , 220114-38-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB415.20 | In Stock |
|
| 5g | RMB415.20 | In Stock |
|
| 1g | RMB1223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| form | Powder |
| color | yellow |
| Sensitive | air sensitive |
| InChIKey | WCMIEHITLHVXIN-UHFFFAOYSA-N |
| SMILES | Cl[Ru]Cl.N[C@@H]([C@H](N)c1ccccc1)c2ccccc2.Cc3cc(C)cc(c3)P(c4cc(C)cc(C)c4)c5ccc6ccccc6c5-c7c(ccc8ccccc78)P(c9cc(C)cc(C)c9)c%10cc(C)cc(C)c%10 |
Description and Uses
RuCl2[(R)-DM-BINAP][(R,R)-DPEN] can catalyze the enantioselective asymmetric reduction of benzils to form the corresponding chiral 1,2-diols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| WGK Germany | 3 |
| HS Code | 2843.90.0000 |
| Storage Class | 11 - Combustible Solids |

![Dichloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II)RuCl2[(R)-xylbinap][(R,R)-dpen]](https://img.chemicalbook.com/CAS/GIF/220114-38-5.gif)


![Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphathyl]ruthenium(II)](https://img.chemicalbook.com/CAS/GIF/132071-87-5.gif)
