A2594512
6-Chloro-2,4-dimethoxypyrimidine , >98.0%(GC) , 6320-15-6
CAS NO.：6320-15-6
Empirical Formula: C6H7ClN2O2
Molecular Weight: 174.59
MDL number: MFCD00006068
EINECS: 228-669-6
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB63.20 | In Stock |
|
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB704.00 | In Stock |
|
| 25G | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C(lit.) |
| Boiling point: | 280.6±43.0 °C(Predicted) |
| Density | 1.285±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, ethyl acetate and methanol. |
| pka | -1.92±0.30(Predicted) |
| form | Solid |
| color | White |
| Sensitive | Hygroscopic |
| BRN | 137581 |
| InChI | InChI=1S/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
| InChIKey | JHNRTJRDRWKAIW-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC(OC)=CC(Cl)=N1 |
| CAS DataBase Reference | 6320-15-6(CAS DataBase Reference) |
Description and Uses
It is used in the synthesis of silyl and stannyl pyrimidines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29335995 |
