A3241212
3,3-Diphenylpropionic acid , 99% , 606-83-7
CAS NO.：606-83-7
Empirical Formula: C15H14O2
Molecular Weight: 226.27
MDL number: MFCD00002717
EINECS: 210-125-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB142.40 | In Stock |
|
| 100G | RMB491.20 | In Stock |
|
| 250g | RMB927.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-154 °C (lit.) |
| Boiling point: | 327.88°C (rough estimate) |
| Density | 1.0891 (rough estimate) |
| refractive index | 1.6530 (estimate) |
| Flash point: | 113 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 4.45±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| Water Solubility | slightly soluble |
| BRN | 1912506 |
| InChI | 1S/C15H14O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17) |
| InChIKey | BZQGAPWJKAYCHR-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 606-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenepropanoic acid, «beta»-phenyl-(606-83-7) |
| EPA Substance Registry System | 3,3-Diphenylpropionic acid (606-83-7) |
Description and Uses
3,3-Diphenylpropionic Acid is used in the preparation of steroid 5α-reductase inhibiting acylpiperidines. It can also be used in the preparation of calpain-inhibitory piptidyl α-ketoacids and esters.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
