A4837512
Heneicosafluoroundecanoic Acid , >97.0%(GC)(T) , 2058-94-8
Synonym(s):
Heneicosafluoroundecanoic acid;PFUnDA
CAS NO.:2058-94-8
Empirical Formula: C11HF21O2
Molecular Weight: 564.09
MDL number: MFCD00153268
EINECS: 218-165-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB87.20 | In Stock |
|
| 1G | RMB239.20 | In Stock |
|
| 5g | RMB750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-101 °C(lit.) |
| Boiling point: | 160 °C60 mm Hg(lit.) |
| Density | 1.7568 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 0.52±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) |
| InChIKey | SIDINRCMMRKXGQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro- (2058-94-8) |
Description and Uses
Perfluorotetradecanoic acid may be used as an analytical reference standard for the quantification of the analyte in water samples using a high-performance liquid chromatography technique.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P202-P260-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 20/21/22-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, CORROSIVE |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |








