A6770112
1H,1H,2H-Perfluoro-1-hexene , 97% , 19430-93-4
Synonym(s):
1H,1H,2H-Perfluoro-1-hexene;3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexene
CAS NO.:19430-93-4
Empirical Formula: C6H3F9
Molecular Weight: 246.07
MDL number: MFCD00042338
EINECS: 243-053-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB359.20 | In Stock |
|
| 500g | RMB1399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 59-60 °C(lit.) |
| Density | 1.452 g/mL at 25 °C(lit.) |
| vapor density | 8.5 (vs air) |
| vapor pressure | 20kPa at 20℃ |
| refractive index | n |
| Flash point: | 1 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | acetone, MEK and trichloroethylene: soluble |
| form | clear liquid |
| color | Colorless to Light yellow to Light red |
| Specific Gravity | 1.457 |
| Water Solubility | 15.6mg/L at 20℃ |
| BRN | 1819716 |
| Exposure limits | ACGIH: TWA 100 ppm |
| InChI | 1S/C6H3F9/c1-2-3(7,8)4(9,10)5(11,12)6(13,14)15/h2H,1H2 |
| InChIKey | GVEUEBXMTMZVSD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C |
| LogP | 4.13 |
| CAS DataBase Reference | 19430-93-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Hexene, 3,3,4,4,5,5,6,6,6-nonafluoro- (19430-93-4) |
Description and Uses
1H,1H,2H-Perfluoro-1-hexene is used to generate fluoropolymeers for use in coatings.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| RTECS | MP7360000 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29033990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Hazardous Substances Data | 19430-93-4(Hazardous Substances Data) |
| Toxicity | LD orl-rat: >25 g/kg CRTXB2 21,149,90 |







