A6853712
2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione , 98% , 446292-08-6
CAS NO.:446292-08-6
Empirical Formula: C22H19N3O6
Molecular Weight: 421.4
MDL number: MFCD11977665
EINECS: 610-201-0
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB319.20 | In Stock |
|
| 25MG | RMB799.20 | In Stock |
|
| 5G | RMB1244.00 | In Stock |
|
| 100MG | RMB1847.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215°C |
| Boiling point: | 702.9±55.0 °C(Predicted) |
| Density | 1.465±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 0.99±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | 12mg/L at 20℃ |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C22H19N3O6/c26-19-13-30-10-9-23(19)14-5-7-15(8-6-14)24-11-16(31-22(24)29)12-25-20(27)17-3-1-2-4-18(17)21(25)28/h1-8,16H,9-13H2/t16-/m1/s1 |
| InChIKey | KUQNYAUTIWQAKY-MRXNPFEDSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C[C@@H]1OC(=O)N(C2=CC=C(N3CCOCC3=O)C=C2)C1 |
| LogP | -0.2 at 25℃ |
Description and Uses
Rivaroxaban intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
| REACH Registrations | Active |

![2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione](https://img.chemicalbook.com/CAS/GIF/446292-08-6.gif)





