A7416912
(1<i>S</i>,3<i>R</i>)-(-)-Camphoric Acid , 98% , 560-09-8
Synonym(s):
(−)-Camphoric acid;(1S,3R)-1,2,2-Trimethyl-1,3-cyclopentanedicarboxylic acid
CAS NO.:560-09-8
Empirical Formula: C10H16O4
Molecular Weight: 200.23
MDL number: MFCD00064937
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB223.20 | In Stock |
|
| 1G | RMB477.60 | In Stock |
|
| 5g | RMB2161.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 312.0±25.0 °C(Predicted) |
| Density | 1.177±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Ethanol, Methanol |
| form | Solid |
| pka | 4.57±0.60(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 48°, c = 10 in ethanol |
| BRN | 1874674 |
| InChI | 1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m0/s1 |
| InChIKey | LSPHULWDVZXLIL-QUBYGPBYSA-N |
| SMILES | CC1(C)[C@@H](CC[C@]1(C)C(O)=O)C(O)=O |
| CAS DataBase Reference | 560-09-8(CAS DataBase Reference) |
Description and Uses
(1S,3R)-()-Camphoric acid can be used:
- As an enantiomeric linker in the preparation of chiral surface-anchored metal-organic frameworks (MOFs).
- To prepare porous MOFs having multifunctional properties; used in gas adsorption and separation of racemic alcohols.
- To prepare a cobalt(II) coordination polymer named {Co(phen)(H2O)[C8H14(COO)2]}n·(CH3OH)n , wherein “phen” is 1,10-phenanthroline and C8H14(COOH)2 is [(1S,3R)-camphoric acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |






