A7762812
(2,2,6,6-Tetramethyl-3,5-heptanedionato)copper(II) , 99% , 14040-05-2
Synonym(s):
2,2,6,6-Tetramethyl-3,5-heptanedione copper(II) derivative;Cu(TMHD)2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB91.20 | In Stock |
|
| 5G | RMB353.60 | In Stock |
|
| 25g | RMB1559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198 °C (dec.)(lit.) |
| Boiling point: | 315 °C |
| Flash point: | 100°C/0.1mm subl. |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | blue |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C11H20O2.Cu/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7-; |
| InChIKey | TWMOCZOBPZKIRU-CFYXSCKTSA-M |
| SMILES | CC(C)(C)C(=O)\C=C(/O[Cu]O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 14040-05-2 |
Description and Uses
Di(dipivaloylmethanato)copper is used in preparation method of doped graphite-like carbon nitride material.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29141900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







