A8212812
4-tert-Butylphenylacetonitrile , 97% , 3288-99-1
CAS NO.：3288-99-1
Empirical Formula: C12H15N
Molecular Weight: 173.25
MDL number: MFCD00128112
EINECS: 221-944-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB245.60 | In Stock |
|
| 500g | RMB704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 79-81°C 0,1mm |
| Density | 0.950±0.06 g/cm3(Predicted) |
| refractive index | 1.51 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Very Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C12H15N/c1-12(2,3)11-6-4-10(5-7-11)8-9-13/h4-7H,8H2,1-3H3 |
| InChIKey | QKJPXROEIJPNHG-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=C(C(C)(C)C)C=C1 |
| LogP | 2.949 (est) |
| CAS DataBase Reference | 3288-99-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetonitrile, 4-(1,1-dimethylethyl)- (3288-99-1) |
Description and Uses
2-(4-tert-Butylphenyl)acetonitrile has been used in the study of cancer by focusing on inhibiting Akt1 and SCD1
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3276 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2926907090 |
