A8496032
                    Hispidulin , 98%(HPLC) , 1447-88-7
                            Synonym(s):
Dinatin;6-Methoxyapigenin;6-Methylscutellarein;Salvitin;Scutellarein 6-methyl ether
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 5MG | RMB711.20 | In Stock | 
                                                 | 
                                        
| 10MG | RMB1159.20 | In Stock | 
                                                 | 
                                        
| 25MG | RMB2399.20 | In Stock | 
                                                 | 
                                        
| 50mg | RMB4255.20 | In Stock | 
                                                 | 
                                        
| 100mg | RMB7663.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 291-292 °C | 
                                    
| Boiling point: | 601.5±55.0 °C(Predicted) | 
                                    
| Density | 1.512±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | -20°C | 
                                    
| solubility | DMSO: soluble20mg/mL, clear | 
                                    
| pka | 6.51±0.40(Predicted) | 
                                    
| form | powder | 
                                    
| color | white to beige | 
                                    
| InChI | InChI=1S/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3 | 
                                    
| InChIKey | IHFBPDAQLQOCBX-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 | 
                                    
Description and Uses
                                            Hispidulin has been used as a calibration standard: 
- in high-performance liquid chromatography (HPLC) for quantification of Clerodendrum petasites flavonoids
 - in liquid chromatography/electrospray ionization mass spectrometry (LC/ESI-MS) analysis
 - in reverse-phase high-performance liquid chromatography with a diode-array detector (HPLC-DAD) and high-performance thin-layer chromatography (HPTLC)
 
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P280-P305+P351+P338 | 
| Hazard Codes | Xn | 
| Risk Statements | 22 | 
| WGK Germany | 3 | 
| RTECS | DJ2996000 | 







