BD3236745
2,2,2-Trifluoro-1-(3-(trifluoromethyl)phenyl)ethanone , 95% , 721-37-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB148.00 | In Stock |
|
| 5g | RMB472.80 | In Stock |
|
| 25g | RMB2358.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-77 °C |
| Boiling point: | 65-67 °C24 mm Hg(lit.) |
| Density | 1.418 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 139 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear, almost colourless (hint of peach) |
| InChI | 1S/C9H4F6O/c10-8(11,12)6-3-1-2-5(4-6)7(16)9(13,14)15/h1-4H |
| InChIKey | MDCHHRZBYSSONX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)c1cccc(c1)C(F)(F)F |
Description and Uses
Preparation of 2,2,2-trifluoro-3′-(trifluoromethyl)acetophenone (3-trifluoromethyltrifluoroacetophenone) by Grignard synthesis using m-trifluoromethylbromo-benzene and trifluoroacetic acid has been reported.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Lachrymator |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 2914790090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |







