S281779
(S)-(?)-o-Tolyl-CBS-oxazaborolidine solution , 0.5?Mintoluene , 463941-07-3
Synonym(s):
(S)-(−)-3,3-Diphenyl-1-o-tolyl-tetrahydropyrrolo(1,2-c)(1,3,2)oxazaborole solution
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB358.94 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 473.3±55.0 °C(Predicted) |
| Density | 0.9009 g/mL at 25 °C |
| refractive index | n20/D 1.514 |
| Flash point: | 7 °C |
| pka | -0.32±0.40(Predicted) |
| InChI | 1S/C24H24BNO/c1-19-11-8-9-16-22(19)25-26-18-10-17-23(26)24(27-25,20-12-4-2-5-13-20)21-14-6-3-7-15-21/h2-9,11-16,23H,10,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | XHMKFCAQQGBIPZ-QHCPKHFHSA-N |
| SMILES | [H][C@@]12CCCN1B(OC2(c3ccccc3)c4ccccc4)c5ccccc5C |
Description and Uses
(S)?-?(-?)?-?o-?Tolyl-?CBS-?oxazaborolidine is a chiral catalyst used in the organic reactions such as enantioselective diels-alder reactions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H361d-H373 |
| Precautionary statements | P210-P261-P281-P301+P310-P331 |
| target organs | Central nervous system |
| Hazard Codes | F,Xn |
| Risk Statements | 11-38-48/20-63-65-67 |
| Safety Statements | 36/37-62-16 |
| RIDADR | UN 1294 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Flam. Liq. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 |






![(S)-1,3,3-Triphenylhexahydropyrrolo[1,2-c][1,3,2]oxazaborole](https://img.chemicalbook.com/CAS/GIF/131180-90-0.gif)

